C25H28F5N3O3S — CID 144850376
5-cyclopropyl-2-fluoro-4-[[1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]-N'-hydroxy-N'-methylsulfanylbenzohydrazide (PubChem CID 144850376) has the molecular formula C25H28F5N3O3S and a molecular weight of 545.57 g/mol. Its IUPAC name is 5-cyclopropyl-2-fluoro-4-[[1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]-N'-hydroxy-N'-methylsulfanylbenzohydrazide.
| Compound Name | 5-cyclopropyl-2-fluoro-4-[[1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]-N'-hydroxy-N'-methylsulfanylbenzohydrazide |
|---|---|
| PubChem CID | 144850376 |
| Molecular Formula | C25H28F5N3O3S |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.18 |
| IUPAC Name | 5-cyclopropyl-2-fluoro-4-[[1-[[4-fluoro-3-(trifluoromethyl)phenyl]methyl]piperidin-4-yl]methoxy]-N'-hydroxy-N'-methylsulfanylbenzohydrazide |
| SMILES | CSN(O)NC(=O)c1cc(C2CC2)c(OCC2CCN(Cc3ccc(F)c(C(F)(F)F)c3)CC2)cc1F |
| InChI | InChI=1S/C25H28F5N3O3S/c1-37-33(35)31-24(34)19-11-18(17-3-4-17)23(12-22(19)27)36-14-15-6-8-32(9-7-15)13-16-2-5-21(26)20(10-16)25(28,29)30/h2,5,10-12,15,17,35H,3-4,6-9,13-14H2,1H3,(H,31,34) |
| InChIKey | VZTDZSZLDRRGNG-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|