C25H30ClF2N3O3S — CID 145194270
4-[[1-[(2-chloro-4-methylphenyl)methyl]-4-fluoropiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide (PubChem CID 145194270) has the molecular formula C25H30ClF2N3O3S and a molecular weight of 526.05 g/mol. Its IUPAC name is 4-[[1-[(2-chloro-4-methylphenyl)methyl]-4-fluoropiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide.
| Compound Name | 4-[[1-[(2-chloro-4-methylphenyl)methyl]-4-fluoropiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide |
|---|---|
| PubChem CID | 145194270 |
| Molecular Formula | C25H30ClF2N3O3S |
| Molecular Weight | 526.05 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 4-[[1-[(2-chloro-4-methylphenyl)methyl]-4-fluoropiperidin-4-yl]methoxy]-5-cyclopropyl-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide |
| SMILES | CSN(O)NC(=O)c1cc(C2CC2)c(OCC2(F)CCN(Cc3ccc(C)cc3Cl)CC2)cc1F |
| InChI | InChI=1S/C25H30ClF2N3O3S/c1-16-3-4-18(21(26)11-16)14-30-9-7-25(28,8-10-30)15-34-23-13-22(27)20(12-19(23)17-5-6-17)24(32)29-31(33)35-2/h3-4,11-13,17,33H,5-10,14-15H2,1-2H3,(H,29,32) |
| InChIKey | NBCYEPCZINXXGR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.05 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|