C23H26Cl2FN3O3S — CID 144850240
5-cyclopropyl-4-[[2-[(3,5-dichlorophenyl)methyl]morpholin-4-yl]methyl]-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide (PubChem CID 144850240) has the molecular formula C23H26Cl2FN3O3S and a molecular weight of 514.45 g/mol. Its IUPAC name is 5-cyclopropyl-4-[[2-[(3,5-dichlorophenyl)methyl]morpholin-4-yl]methyl]-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide.
| Compound Name | 5-cyclopropyl-4-[[2-[(3,5-dichlorophenyl)methyl]morpholin-4-yl]methyl]-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide |
|---|---|
| PubChem CID | 144850240 |
| Molecular Formula | C23H26Cl2FN3O3S |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.11 |
| IUPAC Name | 5-cyclopropyl-4-[[2-[(3,5-dichlorophenyl)methyl]morpholin-4-yl]methyl]-2-fluoro-N'-hydroxy-N'-methylsulfanylbenzohydrazide |
| SMILES | CSN(O)NC(=O)c1cc(C2CC2)c(CN2CCOC(Cc3cc(Cl)cc(Cl)c3)C2)cc1F |
| InChI | InChI=1S/C23H26Cl2FN3O3S/c1-33-29(31)27-23(30)21-11-20(15-2-3-15)16(9-22(21)26)12-28-4-5-32-19(13-28)8-14-6-17(24)10-18(25)7-14/h6-7,9-11,15,19,31H,2-5,8,12-13H2,1H3,(H,27,30) |
| InChIKey | WSGCHWIFCLSNCA-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|