C27H32Cl2FN3O3S — CID 144850650
5-cyclopropyl-N'-cyclopropylsulfanyl-4-[1-[2-(3,5-dichlorophenyl)propan-2-yl]piperidin-3-yl]oxy-2-fluoro-N'-hydroxybenzohydrazide (PubChem CID 144850650) has the molecular formula C27H32Cl2FN3O3S and a molecular weight of 568.54 g/mol. Its IUPAC name is 5-cyclopropyl-N'-cyclopropylsulfanyl-4-[1-[2-(3,5-dichlorophenyl)propan-2-yl]piperidin-3-yl]oxy-2-fluoro-N'-hydroxybenzohydrazide.
| Compound Name | 5-cyclopropyl-N'-cyclopropylsulfanyl-4-[1-[2-(3,5-dichlorophenyl)propan-2-yl]piperidin-3-yl]oxy-2-fluoro-N'-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 144850650 |
| Molecular Formula | C27H32Cl2FN3O3S |
| Molecular Weight | 568.54 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | 5-cyclopropyl-N'-cyclopropylsulfanyl-4-[1-[2-(3,5-dichlorophenyl)propan-2-yl]piperidin-3-yl]oxy-2-fluoro-N'-hydroxybenzohydrazide |
| SMILES | CC(C)(c1cc(Cl)cc(Cl)c1)N1CCCC(Oc2cc(F)c(C(=O)NN(O)SC3CC3)cc2C2CC2)C1 |
| InChI | InChI=1S/C27H32Cl2FN3O3S/c1-27(2,17-10-18(28)12-19(29)11-17)32-9-3-4-20(15-32)36-25-14-24(30)23(13-22(25)16-5-6-16)26(34)31-33(35)37-21-7-8-21/h10-14,16,20-21,35H,3-9,15H2,1-2H3,(H,31,34) |
| InChIKey | KOZVFOIVDGRYTH-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.54 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|