C23H23Cl2FN2O3S — CID 144850342
5-cyclopropyl-4-[1-(3,5-dichlorobenzoyl)piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide (PubChem CID 144850342) has the molecular formula C23H23Cl2FN2O3S and a molecular weight of 497.42 g/mol. Its IUPAC name is 5-cyclopropyl-4-[1-(3,5-dichlorobenzoyl)piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide.
| Compound Name | 5-cyclopropyl-4-[1-(3,5-dichlorobenzoyl)piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 144850342 |
| Molecular Formula | C23H23Cl2FN2O3S |
| Molecular Weight | 497.42 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | 5-cyclopropyl-4-[1-(3,5-dichlorobenzoyl)piperidin-3-yl]oxy-2-fluoro-N-methylsulfanylbenzamide |
| SMILES | CSNC(=O)c1cc(C2CC2)c(OC2CCCN(C(=O)c3cc(Cl)cc(Cl)c3)C2)cc1F |
| InChI | InChI=1S/C23H23Cl2FN2O3S/c1-32-27-22(29)19-10-18(13-4-5-13)21(11-20(19)26)31-17-3-2-6-28(12-17)23(30)14-7-15(24)9-16(25)8-14/h7-11,13,17H,2-6,12H2,1H3,(H,27,29) |
| InChIKey | PJFRPNCASSJFNP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.42 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|