About 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate
1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate (PubChem CID 144850808) has the molecular formula C24H28ClF2NO3
and a molecular weight of 451.94 g/mol. Its IUPAC name is 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate.
Molecular Properties
| Compound Name | 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate |
| PubChem CID | 144850808 |
| Molecular Formula | C24H28ClF2NO3 |
| Molecular Weight | 451.94 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate |
| SMILES | COC(=O)c1cc(C2CC2)c(OC)cc1F.Fc1ccc(CN2CCCCC2)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFN.C12H13FO3/c13-12-8-11(14)5-4-10(12)9-15-6-2-1-3-7-15;1-15-11-6-10(13)9(12(14)16-2)5-8(11)7-3-4-7/h4-5,8H,1-3,6-7,9H2;5-7H,3-4H2,1-2H3 |
| InChIKey | UKKFWELRKYRMJK-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 451.94 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate?
The IUPAC name of 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate (CID 144850808) is 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate.
What is the SMILES notation for 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate?
The canonical SMILES for 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate is COC(=O)c1cc(C2CC2)c(OC)cc1F.Fc1ccc(CN2CCCCC2)c(Cl)c1.
What is the InChIKey of 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate?
The InChIKey is UKKFWELRKYRMJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClFN.C12H13FO3/c13-12-8-11(14)5-4-10(12)9-15-6-2-1-3-7-15;1-15-11-6-10(13)9(12(14)16-2)5-8(11)7-3-4-7/h4-5,8H,1-3,6-7,9H2;5-7H,3-4H2,1-2H3.
What are the key properties of 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate?
1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate has a molecular weight of 451.94 g/mol, XLogP of 5.96, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-4-fluorophenyl)methyl]piperidine;methyl 5-cyclopropyl-2-fluoro-4-methoxybenzoate is sourced from PubChem (CID 144850808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).