C35H39F3N2O2S — CID 144850262
4-[[1-[bis(4-fluorophenyl)methyl]piperidin-4-yl]methoxy]-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide;prop-1-ene (PubChem CID 144850262) has the molecular formula C35H39F3N2O2S and a molecular weight of 608.77 g/mol. Its IUPAC name is 4-[[1-[bis(4-fluorophenyl)methyl]piperidin-4-yl]methoxy]-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide;prop-1-ene.
| Compound Name | 4-[[1-[bis(4-fluorophenyl)methyl]piperidin-4-yl]methoxy]-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide;prop-1-ene |
|---|---|
| PubChem CID | 144850262 |
| Molecular Formula | C35H39F3N2O2S |
| Molecular Weight | 608.77 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | 4-[[1-[bis(4-fluorophenyl)methyl]piperidin-4-yl]methoxy]-5-cyclopropyl-N-cyclopropylsulfanyl-2-fluorobenzamide;prop-1-ene |
| SMILES | C=CC.O=C(NSC1CC1)c1cc(C2CC2)c(OCC2CCN(C(c3ccc(F)cc3)c3ccc(F)cc3)CC2)cc1F |
| InChI | InChI=1S/C32H33F3N2O2S.C3H6/c33-24-7-3-22(4-8-24)31(23-5-9-25(34)10-6-23)37-15-13-20(14-16-37)19-39-30-18-29(35)28(17-27(30)21-1-2-21)32(38)36-40-26-11-12-26;1-3-2/h3-10,17-18,20-21,26,31H,1-2,11-16,19H2,(H,36,38);3H,1H2,2H3 |
| InChIKey | NHAZCTINEDTBDB-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.77 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|