About tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate
tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate (PubChem CID 122699924) has the molecular formula C24H29ClFNO3
and a molecular weight of 433.95 g/mol. Its IUPAC name is tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate.
Molecular Properties
| Compound Name | tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate |
| PubChem CID | 122699924 |
| Molecular Formula | C24H29ClFNO3 |
| Molecular Weight | 433.95 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate |
| SMILES | C[C@@H]1[C@H](Oc2cc(F)c(C(=O)OC(C)(C)C)cc2Cl)CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C24H29ClFNO3/c1-16-21(11-8-12-27(16)15-17-9-6-5-7-10-17)29-22-14-20(26)18(13-19(22)25)23(28)30-24(2,3)4/h5-7,9-10,13-14,16,21H,8,11-12,15H2,1-4H3/t16-,21-/m1/s1 |
| InChIKey | QJGPDJWYJQXSGC-IIBYNOLFSA-N |
| XLogP | 5.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.95 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate?
The IUPAC name of tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate (CID 122699924) is tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate.
What is the SMILES notation for tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate?
The canonical SMILES for tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate is C[C@@H]1[C@H](Oc2cc(F)c(C(=O)OC(C)(C)C)cc2Cl)CCCN1Cc1ccccc1.
What is the InChIKey of tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate?
The InChIKey is QJGPDJWYJQXSGC-IIBYNOLFSA-N. The full InChI is InChI=1S/C24H29ClFNO3/c1-16-21(11-8-12-27(16)15-17-9-6-5-7-10-17)29-22-14-20(26)18(13-19(22)25)23(28)30-24(2,3)4/h5-7,9-10,13-14,16,21H,8,11-12,15H2,1-4H3/t16-,21-/m1/s1.
What are the key properties of tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate?
tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate has a molecular weight of 433.95 g/mol, XLogP of 5.87, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(2R,3R)-1-benzyl-2-methylpiperidin-3-yl]oxy-5-chloro-2-fluorobenzoate is sourced from PubChem (CID 122699924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).