C20H24FO4- — CID 170686646
3-[1-(1-adamantylmethoxy)ethoxy]-4-fluorobenzoate (PubChem CID 170686646) has the molecular formula C20H24FO4- and a molecular weight of 347.41 g/mol. Its IUPAC name is 3-[1-(1-adamantylmethoxy)ethoxy]-4-fluorobenzoate.
| Compound Name | 3-[1-(1-adamantylmethoxy)ethoxy]-4-fluorobenzoate |
|---|---|
| PubChem CID | 170686646 |
| Molecular Formula | C20H24FO4- |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 3-[1-(1-adamantylmethoxy)ethoxy]-4-fluorobenzoate |
| SMILES | CC(OCC12CC3CC(CC(C3)C1)C2)Oc1cc(C(=O)[O-])ccc1F |
| InChI | InChI=1S/C20H25FO4/c1-12(25-18-7-16(19(22)23)2-3-17(18)21)24-11-20-8-13-4-14(9-20)6-15(5-13)10-20/h2-3,7,12-15H,4-6,8-11H2,1H3,(H,22,23)/p-1 |
| InChIKey | MSKVHIGUXMAJJQ-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|