C27H38F2O5 — CID 89089934
1-(1-adamantylmethoxy)ethyl 3-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate (PubChem CID 89089934) has the molecular formula C27H38F2O5 and a molecular weight of 480.59 g/mol. Its IUPAC name is 1-(1-adamantylmethoxy)ethyl 3-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate.
| Compound Name | 1-(1-adamantylmethoxy)ethyl 3-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 89089934 |
| Molecular Formula | C27H38F2O5 |
| Molecular Weight | 480.59 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | 1-(1-adamantylmethoxy)ethyl 3-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate |
| SMILES | CC(OCC12CC3CC(CC(C3)C1)C2)OC(=O)C12CC3CC(CC(OC(=O)C(C)(F)F)(C3)C1)C2 |
| InChI | InChI=1S/C27H38F2O5/c1-16(32-15-25-7-17-3-18(8-25)5-19(4-17)9-25)33-23(31)26-10-20-6-21(11-26)13-27(12-20,14-26)34-22(30)24(2,28)29/h16-21H,3-15H2,1-2H3 |
| InChIKey | DPOHEVIDCCZJGA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.59 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|