C28H40O5 — CID 89211214
1-(1-adamantylmethoxy)ethyl 4-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 89211214) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is 1-(1-adamantylmethoxy)ethyl 4-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | 1-(1-adamantylmethoxy)ethyl 4-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 89211214 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | 1-(1-adamantylmethoxy)ethyl 4-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC1C2CC3CC1CC(C(=O)OC(C)OCC14CC5CC(CC(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C28H40O5/c1-16(2)25(29)33-24-22-7-21-8-23(24)14-28(12-21,13-22)26(30)32-17(3)31-15-27-9-18-4-19(10-27)6-20(5-18)11-27/h17-24H,1,4-15H2,2-3H3 |
| InChIKey | JFJFZPVUXYOJIA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|