C26H36F2O5 — CID 89089933
1-adamantylmethoxymethyl 4-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate (PubChem CID 89089933) has the molecular formula C26H36F2O5 and a molecular weight of 466.57 g/mol. Its IUPAC name is 1-adamantylmethoxymethyl 4-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate.
| Compound Name | 1-adamantylmethoxymethyl 4-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 89089933 |
| Molecular Formula | C26H36F2O5 |
| Molecular Weight | 466.57 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 1-adamantylmethoxymethyl 4-(2,2-difluoropropanoyloxy)adamantane-1-carboxylate |
| SMILES | CC(F)(F)C(=O)OC1C2CC3CC1CC(C(=O)OCOCC14CC5CC(CC(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C26H36F2O5/c1-24(27,28)22(29)33-21-19-5-18-6-20(21)12-26(10-18,11-19)23(30)32-14-31-13-25-7-15-2-16(8-25)4-17(3-15)9-25/h15-21H,2-14H2,1H3 |
| InChIKey | JBRGPAUANUKZRN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.57 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|