C29H42O6 — CID 89211165
1-adamantylmethoxymethyl 4-[2-(2-methylprop-2-enoyloxy)ethoxy]adamantane-1-carboxylate (PubChem CID 89211165) has the molecular formula C29H42O6 and a molecular weight of 486.65 g/mol. Its IUPAC name is 1-adamantylmethoxymethyl 4-[2-(2-methylprop-2-enoyloxy)ethoxy]adamantane-1-carboxylate.
| Compound Name | 1-adamantylmethoxymethyl 4-[2-(2-methylprop-2-enoyloxy)ethoxy]adamantane-1-carboxylate |
|---|---|
| PubChem CID | 89211165 |
| Molecular Formula | C29H42O6 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.30 |
| IUPAC Name | 1-adamantylmethoxymethyl 4-[2-(2-methylprop-2-enoyloxy)ethoxy]adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OCCOC1C2CC3CC1CC(C(=O)OCOCC14CC5CC(CC(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C29H42O6/c1-18(2)26(30)34-4-3-33-25-23-8-22-9-24(25)15-29(13-22,14-23)27(31)35-17-32-16-28-10-19-5-20(11-28)7-21(6-19)12-28/h19-25H,1,3-17H2,2H3 |
| InChIKey | IQZPLRCHWZHJIL-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|