C20H28O6 — CID 90440465
4-O-(1-adamantyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate (PubChem CID 90440465) has the molecular formula C20H28O6 and a molecular weight of 364.44 g/mol. Its IUPAC name is 4-O-(1-adamantyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate.
| Compound Name | 4-O-(1-adamantyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 90440465 |
| Molecular Formula | C20H28O6 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 4-O-(1-adamantyl) 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)OC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H28O6/c1-13(2)19(23)25-6-5-24-17(21)3-4-18(22)26-20-10-14-7-15(11-20)9-16(8-14)12-20/h14-16H,1,3-12H2,2H3 |
| InChIKey | ZRDLQBIOXFFWKC-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|