C25H40O8 — CID 22090270
4-O-[3-(1-ethoxyethoxycarbonyl)-1-adamantyl] 1-O-(1-ethoxyethyl) 2,3-dimethylbutanedioate (PubChem CID 22090270) has the molecular formula C25H40O8 and a molecular weight of 468.59 g/mol. Its IUPAC name is 4-O-[3-(1-ethoxyethoxycarbonyl)-1-adamantyl] 1-O-(1-ethoxyethyl) 2,3-dimethylbutanedioate.
| Compound Name | 4-O-[3-(1-ethoxyethoxycarbonyl)-1-adamantyl] 1-O-(1-ethoxyethyl) 2,3-dimethylbutanedioate |
|---|---|
| PubChem CID | 22090270 |
| Molecular Formula | C25H40O8 |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 4-O-[3-(1-ethoxyethoxycarbonyl)-1-adamantyl] 1-O-(1-ethoxyethyl) 2,3-dimethylbutanedioate |
| SMILES | CCOC(C)OC(=O)C(C)C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OC(C)OCC)(C3)C2 |
| InChI | InChI=1S/C25H40O8/c1-7-29-17(5)31-21(26)15(3)16(4)22(27)33-25-12-19-9-20(13-25)11-24(10-19,14-25)23(28)32-18(6)30-8-2/h15-20H,7-14H2,1-6H3 |
| InChIKey | JZROKWMXMJLKIV-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|