C27H46O5 — CID 118100481
[3,3-dimethyl-1-(2-methylpropoxy)butyl] 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate (PubChem CID 118100481) has the molecular formula C27H46O5 and a molecular weight of 450.66 g/mol. Its IUPAC name is [3,3-dimethyl-1-(2-methylpropoxy)butyl] 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate.
| Compound Name | [3,3-dimethyl-1-(2-methylpropoxy)butyl] 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 118100481 |
| Molecular Formula | C27H46O5 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | [3,3-dimethyl-1-(2-methylpropoxy)butyl] 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate |
| SMILES | CCC(C)(C)C(=O)OC12CC3CC(C1)CC(C(=O)OC(CC(C)(C)C)OCC(C)C)(C3)C2 |
| InChI | InChI=1S/C27H46O5/c1-9-25(7,8)22(28)32-27-13-19-10-20(14-27)12-26(11-19,17-27)23(29)31-21(15-24(4,5)6)30-16-18(2)3/h18-21H,9-17H2,1-8H3 |
| InChIKey | GGSJVJWLGSSLIM-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|