C27H42O8 — CID 91553912
2,2-dimethylbutanoic acid;(2-oxooxolan-3-yl) 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate (PubChem CID 91553912) has the molecular formula C27H42O8 and a molecular weight of 494.63 g/mol. Its IUPAC name is 2,2-dimethylbutanoic acid;(2-oxooxolan-3-yl) 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate.
| Compound Name | 2,2-dimethylbutanoic acid;(2-oxooxolan-3-yl) 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 91553912 |
| Molecular Formula | C27H42O8 |
| Molecular Weight | 494.63 g/mol |
| Exact Mass | 494.29 |
| IUPAC Name | 2,2-dimethylbutanoic acid;(2-oxooxolan-3-yl) 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate |
| SMILES | CCC(C)(C)C(=O)O.CCC(C)(C)C(=O)OC12CC3CC(C1)CC(C(=O)OC1CCOC1=O)(C3)C2 |
| InChI | InChI=1S/C21H30O6.C6H12O2/c1-4-19(2,3)17(23)27-21-10-13-7-14(11-21)9-20(8-13,12-21)18(24)26-15-5-6-25-16(15)22;1-4-6(2,3)5(7)8/h13-15H,4-12H2,1-3H3;4H2,1-3H3,(H,7,8) |
| InChIKey | DJIRQAMOTGXRPK-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.63 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|