C25H39F7O4 — CID 158469966
3,3,5,5,6,6,6-heptafluorohexyl 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate;methane (PubChem CID 158469966) has the molecular formula C25H39F7O4 and a molecular weight of 536.57 g/mol. Its IUPAC name is 3,3,5,5,6,6,6-heptafluorohexyl 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate;methane.
| Compound Name | 3,3,5,5,6,6,6-heptafluorohexyl 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate;methane |
|---|---|
| PubChem CID | 158469966 |
| Molecular Formula | C25H39F7O4 |
| Molecular Weight | 536.57 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 3,3,5,5,6,6,6-heptafluorohexyl 3-(2,2-dimethylbutanoyloxy)adamantane-1-carboxylate;methane |
| SMILES | C.C.CCC(C)(C)C(=O)OC12CC3CC(C1)CC(C(=O)OCCC(F)(F)CC(F)(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C23H31F7O4.2CH4/c1-4-18(2,3)16(31)34-20-10-14-7-15(11-20)9-19(8-14,12-20)17(32)33-6-5-21(24,25)13-22(26,27)23(28,29)30;;/h14-15H,4-13H2,1-3H3;2*1H4 |
| InChIKey | HGFRKHYWVMJMAI-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.57 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|