C18H20F6O7 — CID 164747449
2,2,3,3,4,4-hexafluoro-5-[[3-(2-hydroxyethoxycarbonyl)-1-adamantyl]oxy]-5-oxopentanoic acid (PubChem CID 164747449) has the molecular formula C18H20F6O7 and a molecular weight of 462.34 g/mol. Its IUPAC name is 2,2,3,3,4,4-hexafluoro-5-[[3-(2-hydroxyethoxycarbonyl)-1-adamantyl]oxy]-5-oxopentanoic acid.
| Compound Name | 2,2,3,3,4,4-hexafluoro-5-[[3-(2-hydroxyethoxycarbonyl)-1-adamantyl]oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 164747449 |
| Molecular Formula | C18H20F6O7 |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 462.11 |
| IUPAC Name | 2,2,3,3,4,4-hexafluoro-5-[[3-(2-hydroxyethoxycarbonyl)-1-adamantyl]oxy]-5-oxopentanoic acid |
| SMILES | O=C(OCCO)C12CC3CC(CC(OC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)O)(C3)C1)C2 |
| InChI | InChI=1S/C18H20F6O7/c19-16(20,11(26)27)18(23,24)17(21,22)13(29)31-15-6-9-3-10(7-15)5-14(4-9,8-15)12(28)30-2-1-25/h9-10,25H,1-8H2,(H,26,27) |
| InChIKey | BYMMWCSNNMGMTF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|