About 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate
2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate (PubChem CID 170100615) has the molecular formula C19H30O4S
and a molecular weight of 354.51 g/mol. Its IUPAC name is 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate.
Molecular Properties
| Compound Name | 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate |
| PubChem CID | 170100615 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate |
| SMILES | CSCCOC(=O)C12CC3CC(CC(OC(=O)C(C)(C)C)(C3)C1)C2 |
| InChI | InChI=1S/C19H30O4S/c1-17(2,3)15(20)23-19-10-13-7-14(11-19)9-18(8-13,12-19)16(21)22-5-6-24-4/h13-14H,5-12H2,1-4H3 |
| InChIKey | QVAWUGKOCYJXJX-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate?
The IUPAC name of 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate (CID 170100615) is 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate.
What is the SMILES notation for 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate?
The canonical SMILES for 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate is CSCCOC(=O)C12CC3CC(CC(OC(=O)C(C)(C)C)(C3)C1)C2.
What is the InChIKey of 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate?
The InChIKey is QVAWUGKOCYJXJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H30O4S/c1-17(2,3)15(20)23-19-10-13-7-14(11-19)9-18(8-13,12-19)16(21)22-5-6-24-4/h13-14H,5-12H2,1-4H3.
What are the key properties of 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate?
2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate has a molecular weight of 354.51 g/mol, XLogP of 3.82, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl 3-(2,2-dimethylpropanoyloxy)adamantane-1-carboxylate is sourced from PubChem (CID 170100615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).