C17H24O7S — CID 88912289
2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid (PubChem CID 88912289) has the molecular formula C17H24O7S and a molecular weight of 372.44 g/mol. Its IUPAC name is 2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 88912289 |
| Molecular Formula | C17H24O7S |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-[3-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OCCS(=O)(=O)O)(C3)C2 |
| InChI | InChI=1S/C17H24O7S/c1-11(2)14(18)24-17-8-12-5-13(9-17)7-16(6-12,10-17)15(19)23-3-4-25(20,21)22/h12-13H,1,3-10H2,2H3,(H,20,21,22) |
| InChIKey | PHBRBKQNLOOHGS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|