C18H26O7S — CID 129061928
2-[2-methyl-2-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid (PubChem CID 129061928) has the molecular formula C18H26O7S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-[2-methyl-2-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid.
| Compound Name | 2-[2-methyl-2-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 129061928 |
| Molecular Formula | C18H26O7S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-[2-methyl-2-(2-methylprop-2-enoyloxy)adamantane-1-carbonyl]oxyethanesulfonic acid |
| SMILES | C=C(C)C(=O)OC1(C)C2CC3CC(C2)CC1(C(=O)OCCS(=O)(=O)O)C3 |
| InChI | InChI=1S/C18H26O7S/c1-11(2)15(19)25-17(3)14-7-12-6-13(8-14)10-18(17,9-12)16(20)24-4-5-26(21,22)23/h12-14H,1,4-10H2,2-3H3,(H,21,22,23) |
| InChIKey | WASQQBFINHCCGO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|