C16H22O2 — CID 129102806
2-(4-tetracyclo[4.3.1.02,4.02,8]decanyl)ethyl 2-methylprop-2-enoate (PubChem CID 129102806) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-(4-tetracyclo[4.3.1.02,4.02,8]decanyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(4-tetracyclo[4.3.1.02,4.02,8]decanyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129102806 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 2-(4-tetracyclo[4.3.1.02,4.02,8]decanyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC12CC3CC4CC(C3)C41C2 |
| InChI | InChI=1S/C16H22O2/c1-10(2)14(17)18-4-3-15-8-11-5-12-7-13(6-11)16(12,15)9-15/h11-13H,1,3-9H2,2H3 |
| InChIKey | WRFHOYDMEXZQMA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|