C19H26O5 — CID 151559198
[2-[2-(2-methyl-2-adamantyl)acetyl]oxy-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 151559198) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [2-[2-(2-methyl-2-adamantyl)acetyl]oxy-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[2-(2-methyl-2-adamantyl)acetyl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151559198 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [2-[2-(2-methyl-2-adamantyl)acetyl]oxy-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC(=O)CC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H26O5/c1-11(2)18(22)23-10-17(21)24-16(20)9-19(3)14-5-12-4-13(7-14)8-15(19)6-12/h12-15H,1,4-10H2,2-3H3 |
| InChIKey | QCCPWJPFVJLIDS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|