C39H58O8 — CID 91269774
[2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate;[2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 91269774) has the molecular formula C39H58O8 and a molecular weight of 654.89 g/mol. Its IUPAC name is [2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate;[2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate;[2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 91269774 |
| Molecular Formula | C39H58O8 |
| Molecular Weight | 654.89 g/mol |
| Exact Mass | 654.41 |
| IUPAC Name | [2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate;[2-[[2-(2-methylpropyl)-2-adamantyl]oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1(CC(C)C)C2CC3CC(C2)CC1C3.C=CC(=O)OCC(=O)OC1(CC(C)C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H30O4.C19H28O4/c1-12(2)10-20(24-18(21)11-23-19(22)13(3)4)16-6-14-5-15(8-16)9-17(20)7-14;1-4-17(20)22-11-18(21)23-19(10-12(2)3)15-6-13-5-14(8-15)9-16(19)7-13/h12,14-17H,3,5-11H2,1-2,4H3;4,12-16H,1,5-11H2,2-3H3 |
| InChIKey | AYTLTYHULZJEBA-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.89 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|