C20H30O4 — CID 69439306
(2-ethyl-2-adamantyl) 2-(2-methylprop-2-enoyloxy)butanoate (PubChem CID 69439306) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 2-(2-methylprop-2-enoyloxy)butanoate.
| Compound Name | (2-ethyl-2-adamantyl) 2-(2-methylprop-2-enoyloxy)butanoate |
|---|---|
| PubChem CID | 69439306 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (2-ethyl-2-adamantyl) 2-(2-methylprop-2-enoyloxy)butanoate |
| SMILES | C=C(C)C(=O)OC(CC)C(=O)OC1(CC)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H30O4/c1-5-17(23-18(21)12(3)4)19(22)24-20(6-2)15-8-13-7-14(10-15)11-16(20)9-13/h13-17H,3,5-11H2,1-2,4H3 |
| InChIKey | FFSRHZKTQCFOFS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|