C21H32O3 — CID 59999980
[2-(4,4-dimethyl-2-oxopentyl)-2-adamantyl] 2-methylprop-2-enoate (PubChem CID 59999980) has the molecular formula C21H32O3 and a molecular weight of 332.48 g/mol. Its IUPAC name is [2-(4,4-dimethyl-2-oxopentyl)-2-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [2-(4,4-dimethyl-2-oxopentyl)-2-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59999980 |
| Molecular Formula | C21H32O3 |
| Molecular Weight | 332.48 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | [2-(4,4-dimethyl-2-oxopentyl)-2-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC(=O)CC(C)(C)C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C21H32O3/c1-13(2)19(23)24-21(12-18(22)11-20(3,4)5)16-7-14-6-15(9-16)10-17(21)8-14/h14-17H,1,6-12H2,2-5H3 |
| InChIKey | MNJNHWQJVHLCQV-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|