C16H21CsO4 — CID 166436919
cesium 2-[[2-(2-methylprop-2-enyl)-2-adamantyl]oxy]-2-oxoacetate (PubChem CID 166436919) has the molecular formula C16H21CsO4 and a molecular weight of 410.25 g/mol. Its IUPAC name is cesium 2-[[2-(2-methylprop-2-enyl)-2-adamantyl]oxy]-2-oxoacetate.
| Compound Name | cesium 2-[[2-(2-methylprop-2-enyl)-2-adamantyl]oxy]-2-oxoacetate |
|---|---|
| PubChem CID | 166436919 |
| Molecular Formula | C16H21CsO4 |
| Molecular Weight | 410.25 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | cesium 2-[[2-(2-methylprop-2-enyl)-2-adamantyl]oxy]-2-oxoacetate |
| SMILES | C=C(C)CC1(OC(=O)C(=O)[O-])C2CC3CC(C2)CC1C3.[Cs+] |
| InChI | InChI=1S/C16H22O4.Cs/c1-9(2)8-16(20-15(19)14(17)18)12-4-10-3-11(6-12)7-13(16)5-10;/h10-13H,1,3-8H2,2H3,(H,17,18);/q;+1/p-1 |
| InChIKey | VBPBTUDBZKGEFL-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.25 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|