C18H26F4O2 — CID 58761452
(2-ethyl-2-adamantyl) 2-(fluoromethyl)-2-(trifluoromethyl)butanoate (PubChem CID 58761452) has the molecular formula C18H26F4O2 and a molecular weight of 350.40 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 2-(fluoromethyl)-2-(trifluoromethyl)butanoate.
| Compound Name | (2-ethyl-2-adamantyl) 2-(fluoromethyl)-2-(trifluoromethyl)butanoate |
|---|---|
| PubChem CID | 58761452 |
| Molecular Formula | C18H26F4O2 |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | (2-ethyl-2-adamantyl) 2-(fluoromethyl)-2-(trifluoromethyl)butanoate |
| SMILES | CCC1(OC(=O)C(CC)(CF)C(F)(F)F)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H26F4O2/c1-3-16(10-19,18(20,21)22)15(23)24-17(4-2)13-6-11-5-12(8-13)9-14(17)7-11/h11-14H,3-10H2,1-2H3 |
| InChIKey | VYIBTWJLDLCGLV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |