C27H38F2O8S — CID 88579287
2-[[2-ethyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 88579287) has the molecular formula C27H38F2O8S and a molecular weight of 560.66 g/mol. Its IUPAC name is 2-[[2-ethyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[2-ethyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88579287 |
| Molecular Formula | C27H38F2O8S |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | 2-[[2-ethyl-5-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1(OC(=O)C(F)(F)S(=O)(=O)O)C2CC3CC1CC(OCC(=O)OC1(C)C4CC5CC(C4)CC1C5)(C3)C2 |
| InChI | InChI=1S/C27H38F2O8S/c1-3-26(37-23(31)27(28,29)38(32,33)34)20-9-17-10-21(26)13-25(11-17,12-20)35-14-22(30)36-24(2)18-5-15-4-16(7-18)8-19(24)6-15/h15-21H,3-14H2,1-2H3,(H,32,33,34) |
| InChIKey | ARPJAFABMIUEFC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|