C29H40F2O12S — CID 88946587
2-[2-[[3,5-dihydroxy-7-[2-oxo-2-[(2-propan-2-yl-2-adamantyl)oxy]ethoxy]-1-adamantyl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 88946587) has the molecular formula C29H40F2O12S and a molecular weight of 650.69 g/mol. Its IUPAC name is 2-[2-[[3,5-dihydroxy-7-[2-oxo-2-[(2-propan-2-yl-2-adamantyl)oxy]ethoxy]-1-adamantyl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-[[3,5-dihydroxy-7-[2-oxo-2-[(2-propan-2-yl-2-adamantyl)oxy]ethoxy]-1-adamantyl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88946587 |
| Molecular Formula | C29H40F2O12S |
| Molecular Weight | 650.69 g/mol |
| Exact Mass | 650.22 |
| IUPAC Name | 2-[2-[[3,5-dihydroxy-7-[2-oxo-2-[(2-propan-2-yl-2-adamantyl)oxy]ethoxy]-1-adamantyl]oxy]-2-oxoethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CC(C)C1(OC(=O)COC23CC4(O)CC(O)(C2)CC(OC(=O)COC(=O)C(F)(F)S(=O)(=O)O)(C4)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C29H40F2O12S/c1-16(2)28(19-4-17-3-18(6-19)7-20(28)5-17)43-22(33)9-41-26-11-24(35)10-25(36,12-26)14-27(13-24,15-26)42-21(32)8-40-23(34)29(30,31)44(37,38)39/h16-20,35-36H,3-15H2,1-2H3,(H,37,38,39) |
| InChIKey | DPWWQTIOKONPPK-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.69 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|