C28H40F2O10S — CID 88942519
2-[2-[[2-ethyl-5-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]ethoxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 88942519) has the molecular formula C28H40F2O10S and a molecular weight of 606.68 g/mol. Its IUPAC name is 2-[2-[[2-ethyl-5-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]ethoxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[2-[[2-ethyl-5-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]ethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88942519 |
| Molecular Formula | C28H40F2O10S |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.23 |
| IUPAC Name | 2-[2-[[2-ethyl-5-[2-[(3-hydroxy-1-adamantyl)oxy]-2-oxoethoxy]-2-adamantyl]oxy]ethoxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1(OCCOC(=O)C(F)(F)S(=O)(=O)O)C2CC3CC1CC(OCC(=O)OC14CC5CC(CC(O)(C5)C1)C4)(C3)C2 |
| InChI | InChI=1S/C28H40F2O10S/c1-2-27(38-4-3-37-23(32)28(29,30)41(34,35)36)20-6-17-7-21(27)14-25(10-17,13-20)39-15-22(31)40-26-11-18-5-19(12-26)9-24(33,8-18)16-26/h17-21,33H,2-16H2,1H3,(H,34,35,36) |
| InChIKey | ATOKMUYDESSQCQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|