C27H38F2O11S — CID 88946612
2-[[3,5-dihydroxy-7-[2-[2-[(2-methyl-2-adamantyl)oxy]ethoxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 88946612) has the molecular formula C27H38F2O11S and a molecular weight of 608.65 g/mol. Its IUPAC name is 2-[[3,5-dihydroxy-7-[2-[2-[(2-methyl-2-adamantyl)oxy]ethoxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[[3,5-dihydroxy-7-[2-[2-[(2-methyl-2-adamantyl)oxy]ethoxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 88946612 |
| Molecular Formula | C27H38F2O11S |
| Molecular Weight | 608.65 g/mol |
| Exact Mass | 608.21 |
| IUPAC Name | 2-[[3,5-dihydroxy-7-[2-[2-[(2-methyl-2-adamantyl)oxy]ethoxy]-2-oxoethoxy]-1-adamantyl]oxy]-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CC1(OCCOC(=O)COC23CC4(O)CC(O)(C2)CC(OC(=O)C(F)(F)S(=O)(=O)O)(C4)C3)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H38F2O11S/c1-22(18-5-16-4-17(7-18)8-19(22)6-16)38-3-2-37-20(30)9-39-25-11-23(32)10-24(33,12-25)14-26(13-23,15-25)40-21(31)27(28,29)41(34,35)36/h16-19,32-33H,2-15H2,1H3,(H,34,35,36) |
| InChIKey | CPUZHPYIDIMBLK-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.65 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|