C17H24F2O7S — CID 87141641
1,1-difluoro-2-[2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid (PubChem CID 87141641) has the molecular formula C17H24F2O7S and a molecular weight of 410.44 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 87141641 |
| Molecular Formula | C17H24F2O7S |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1,1-difluoro-2-[2-methyl-3-[(2-methyl-2-adamantyl)oxy]-3-oxopropoxy]-2-oxoethanesulfonic acid |
| SMILES | CC(COC(=O)C(F)(F)S(=O)(=O)O)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H24F2O7S/c1-9(8-25-15(21)17(18,19)27(22,23)24)14(20)26-16(2)12-4-10-3-11(6-12)7-13(16)5-10/h9-13H,3-8H2,1-2H3,(H,22,23,24) |
| InChIKey | KCYJAVPYHLSRPN-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|