C17H27F3O2 — CID 90738806
fluoroform;(2-methyl-2-adamantyl) 2-methylbutanoate (PubChem CID 90738806) has the molecular formula C17H27F3O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is fluoroform;(2-methyl-2-adamantyl) 2-methylbutanoate.
| Compound Name | fluoroform;(2-methyl-2-adamantyl) 2-methylbutanoate |
|---|---|
| PubChem CID | 90738806 |
| Molecular Formula | C17H27F3O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | fluoroform;(2-methyl-2-adamantyl) 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OC1(C)C2CC3CC(C2)CC1C3.FC(F)F |
| InChI | InChI=1S/C16H26O2.CHF3/c1-4-10(2)15(17)18-16(3)13-6-11-5-12(8-13)9-14(16)7-11;2-1(3)4/h10-14H,4-9H2,1-3H3;1H |
| InChIKey | ARLFSLGJUCAQQP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |