C34H46F2O13S — CID 89418741
2-[1,4-bis[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1,4-dioxobutan-2-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid (PubChem CID 89418741) has the molecular formula C34H46F2O13S and a molecular weight of 732.79 g/mol. Its IUPAC name is 2-[1,4-bis[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1,4-dioxobutan-2-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid.
| Compound Name | 2-[1,4-bis[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1,4-dioxobutan-2-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89418741 |
| Molecular Formula | C34H46F2O13S |
| Molecular Weight | 732.79 g/mol |
| Exact Mass | 732.26 |
| IUPAC Name | 2-[1,4-bis[2-[(2-ethyl-2-adamantyl)oxy]-2-oxoethoxy]-1,4-dioxobutan-2-yl]oxy-1,1-difluoro-2-oxoethanesulfonic acid |
| SMILES | CCC1(OC(=O)COC(=O)CC(OC(=O)C(F)(F)S(=O)(=O)O)C(=O)OCC(=O)OC2(CC)C3CC4CC(C3)CC2C4)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C34H46F2O13S/c1-3-32(22-7-18-5-19(9-22)10-23(32)8-18)48-28(38)16-45-27(37)15-26(47-31(41)34(35,36)50(42,43)44)30(40)46-17-29(39)49-33(4-2)24-11-20-6-21(13-24)14-25(33)12-20/h18-26H,3-17H2,1-2H3,(H,42,43,44) |
| InChIKey | INDISUMWOGLCOT-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.79 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|