C19H26F2O10S — CID 89037170
1,1-difluoro-2-[2-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]ethoxy]-2-oxoethanesulfonic acid (PubChem CID 89037170) has the molecular formula C19H26F2O10S and a molecular weight of 484.47 g/mol. Its IUPAC name is 1,1-difluoro-2-[2-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]ethoxy]-2-oxoethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[2-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]ethoxy]-2-oxoethanesulfonic acid |
|---|---|
| PubChem CID | 89037170 |
| Molecular Formula | C19H26F2O10S |
| Molecular Weight | 484.47 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | 1,1-difluoro-2-[2-[2-[2-[(2-methyl-2-adamantyl)oxy]-2-oxoethoxy]-2-oxoethoxy]ethoxy]-2-oxoethanesulfonic acid |
| SMILES | CC1(OC(=O)COC(=O)COCCOC(=O)C(F)(F)S(=O)(=O)O)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C19H26F2O10S/c1-18(13-5-11-4-12(7-13)8-14(18)6-11)31-16(23)10-30-15(22)9-28-2-3-29-17(24)19(20,21)32(25,26)27/h11-14H,2-10H2,1H3,(H,25,26,27) |
| InChIKey | GTYTUFVWIHEZRY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.47 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|