C17H27FO2 — CID 58823640
(2-ethyl-2-adamantyl) 2-fluoro-2-methylbutanoate (PubChem CID 58823640) has the molecular formula C17H27FO2 and a molecular weight of 282.40 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 2-fluoro-2-methylbutanoate.
| Compound Name | (2-ethyl-2-adamantyl) 2-fluoro-2-methylbutanoate |
|---|---|
| PubChem CID | 58823640 |
| Molecular Formula | C17H27FO2 |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | (2-ethyl-2-adamantyl) 2-fluoro-2-methylbutanoate |
| SMILES | CCC(C)(F)C(=O)OC1(CC)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H27FO2/c1-4-16(3,18)15(19)20-17(5-2)13-7-11-6-12(9-13)10-14(17)8-11/h11-14H,4-10H2,1-3H3 |
| InChIKey | CAYXCJVPSYJOIM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |