C20H34O3 — CID 23528275
[2-(3-methoxypropyl)-2-adamantyl] 2,2-dimethylbutanoate (PubChem CID 23528275) has the molecular formula C20H34O3 and a molecular weight of 322.49 g/mol. Its IUPAC name is [2-(3-methoxypropyl)-2-adamantyl] 2,2-dimethylbutanoate.
| Compound Name | [2-(3-methoxypropyl)-2-adamantyl] 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 23528275 |
| Molecular Formula | C20H34O3 |
| Molecular Weight | 322.49 g/mol |
| Exact Mass | 322.25 |
| IUPAC Name | [2-(3-methoxypropyl)-2-adamantyl] 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(CCCOC)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H34O3/c1-5-19(2,3)18(21)23-20(7-6-8-22-4)16-10-14-9-15(12-16)13-17(20)11-14/h14-17H,5-13H2,1-4H3 |
| InChIKey | SOUDWPMITKWRSY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|