C28H50O5 — CID 91016179
(1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;(2-methyl-2-adamantyl) 2,2-dimethylbutanoate (PubChem CID 91016179) has the molecular formula C28H50O5 and a molecular weight of 466.70 g/mol. Its IUPAC name is (1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;(2-methyl-2-adamantyl) 2,2-dimethylbutanoate.
| Compound Name | (1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;(2-methyl-2-adamantyl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91016179 |
| Molecular Formula | C28H50O5 |
| Molecular Weight | 466.70 g/mol |
| Exact Mass | 466.37 |
| IUPAC Name | (1-methoxy-2-methylpropyl) 2,2-dimethylbutanoate;(2-methyl-2-adamantyl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC(OC)C(C)C.CCC(C)(C)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H28O2.C11H22O3/c1-5-16(2,3)15(18)19-17(4)13-7-11-6-12(9-13)10-14(17)8-11;1-7-11(4,5)10(12)14-9(13-6)8(2)3/h11-14H,5-10H2,1-4H3;8-9H,7H2,1-6H3 |
| InChIKey | QSOTUCDJHUJUPN-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|