C23H34O5 — CID 20710372
(2-ethyl-2-adamantyl) 2-methyl-2-[(3-methyl-2,5-dioxooxolan-3-yl)methyl]butanoate (PubChem CID 20710372) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (2-ethyl-2-adamantyl) 2-methyl-2-[(3-methyl-2,5-dioxooxolan-3-yl)methyl]butanoate.
| Compound Name | (2-ethyl-2-adamantyl) 2-methyl-2-[(3-methyl-2,5-dioxooxolan-3-yl)methyl]butanoate |
|---|---|
| PubChem CID | 20710372 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2-ethyl-2-adamantyl) 2-methyl-2-[(3-methyl-2,5-dioxooxolan-3-yl)methyl]butanoate |
| SMILES | CCC(C)(CC1(C)CC(=O)OC1=O)C(=O)OC1(CC)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H34O5/c1-5-21(3,13-22(4)12-18(24)27-19(22)25)20(26)28-23(6-2)16-8-14-7-15(10-16)11-17(23)9-14/h14-17H,5-13H2,1-4H3 |
| InChIKey | LCPQIMXXZZWFFC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|