C33H52O8 — CID 59049045
2,2,4,6-tetramethyl-4-(4-methyl-2-oxooxan-4-yl)oxycarbonyl-6-[(2-propyl-2-adamantyl)oxycarbonyl]octanoic acid (PubChem CID 59049045) has the molecular formula C33H52O8 and a molecular weight of 576.77 g/mol. Its IUPAC name is 2,2,4,6-tetramethyl-4-(4-methyl-2-oxooxan-4-yl)oxycarbonyl-6-[(2-propyl-2-adamantyl)oxycarbonyl]octanoic acid.
| Compound Name | 2,2,4,6-tetramethyl-4-(4-methyl-2-oxooxan-4-yl)oxycarbonyl-6-[(2-propyl-2-adamantyl)oxycarbonyl]octanoic acid |
|---|---|
| PubChem CID | 59049045 |
| Molecular Formula | C33H52O8 |
| Molecular Weight | 576.77 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | 2,2,4,6-tetramethyl-4-(4-methyl-2-oxooxan-4-yl)oxycarbonyl-6-[(2-propyl-2-adamantyl)oxycarbonyl]octanoic acid |
| SMILES | CCCC1(OC(=O)C(C)(CC)CC(C)(CC(C)(C)C(=O)O)C(=O)OC2(C)CCOC(=O)C2)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C33H52O8/c1-8-10-33(23-14-21-13-22(16-23)17-24(33)15-21)41-27(37)30(5,9-2)20-31(6,19-29(3,4)26(35)36)28(38)40-32(7)11-12-39-25(34)18-32/h21-24H,8-20H2,1-7H3,(H,35,36) |
| InChIKey | ZWIRHPBIELKPGT-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.77 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|