C27H42O6 — CID 59083544
1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-(2-methyl-2-adamantyl) 4-ethyl-2,2,4-trimethylpentanedioate (PubChem CID 59083544) has the molecular formula C27H42O6 and a molecular weight of 462.63 g/mol. Its IUPAC name is 1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-(2-methyl-2-adamantyl) 4-ethyl-2,2,4-trimethylpentanedioate.
| Compound Name | 1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-(2-methyl-2-adamantyl) 4-ethyl-2,2,4-trimethylpentanedioate |
|---|---|
| PubChem CID | 59083544 |
| Molecular Formula | C27H42O6 |
| Molecular Weight | 462.63 g/mol |
| Exact Mass | 462.30 |
| IUPAC Name | 1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-(2-methyl-2-adamantyl) 4-ethyl-2,2,4-trimethylpentanedioate |
| SMILES | CCC(C)(CC(C)(C)C(=O)OC1CC(C)(C)OC1=O)C(=O)OC1(C)C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C27H42O6/c1-8-26(6,15-24(2,3)22(29)31-20-14-25(4,5)32-21(20)28)23(30)33-27(7)18-10-16-9-17(12-18)13-19(27)11-16/h16-20H,8-15H2,1-7H3 |
| InChIKey | KLDGUUMLKWIFGG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.63 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|