C45H70O11 — CID 20622060
3-O-(3,5-dihydroxy-1-adamantyl) 1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20622060) has the molecular formula C45H70O11 and a molecular weight of 787.04 g/mol. Its IUPAC name is 3-O-(3,5-dihydroxy-1-adamantyl) 1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(3,5-dihydroxy-1-adamantyl) 1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20622060 |
| Molecular Formula | C45H70O11 |
| Molecular Weight | 787.04 g/mol |
| Exact Mass | 786.49 |
| IUPAC Name | 3-O-(3,5-dihydroxy-1-adamantyl) 1-O-(5,5-dimethyl-2-oxooxolan-3-yl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC1CC(C)(C)OC1=O)C(=O)OC12CC3CC(O)(CC(O)(C3)C1)C2)C(=O)OC(C)(C(C)C)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C45H70O11/c1-11-38(8,34(48)55-40(10,27(2)3)41-13-28-12-29(14-41)16-42(50,15-28)23-41)22-39(9,21-36(4,5)33(47)53-31-20-37(6,7)54-32(31)46)35(49)56-45-19-30-17-43(51,25-45)24-44(52,18-30)26-45/h27-31,50-52H,11-26H2,1-10H3 |
| InChIKey | FLEKXGOEPIHKMT-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.04 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|