C46H72O10 — CID 20622081
3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(2,2,3-trimethyl-5-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate (PubChem CID 20622081) has the molecular formula C46H72O10 and a molecular weight of 785.07 g/mol. Its IUPAC name is 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(2,2,3-trimethyl-5-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate.
| Compound Name | 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(2,2,3-trimethyl-5-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 20622081 |
| Molecular Formula | C46H72O10 |
| Molecular Weight | 785.07 g/mol |
| Exact Mass | 784.51 |
| IUPAC Name | 3-O-(3-hydroxy-1-adamantyl) 5-O-[2-(3-hydroxy-1-adamantyl)-3-methylbutan-2-yl] 1-O-(2,2,3-trimethyl-5-oxooxolan-3-yl) 1,1,3,5-tetramethylheptane-1,3,5-tricarboxylate |
| SMILES | CCC(C)(CC(C)(CC(C)(C)C(=O)OC1(C)CC(=O)OC1(C)C)C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(=O)OC(C)(C(C)C)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C46H72O10/c1-12-39(8,35(49)55-42(11,28(2)3)43-15-29-13-30(16-43)18-44(51,17-29)26-43)25-40(9,24-37(4,5)34(48)54-41(10)23-33(47)53-38(41,6)7)36(50)56-46-21-31-14-32(22-46)20-45(52,19-31)27-46/h28-32,51-52H,12-27H2,1-11H3 |
| InChIKey | UUTFPLDSUBZHLJ-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 145.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.07 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|