C19H32O3 — CID 134214124
(3-hydroxy-1-adamantyl) 2,3-dimethyl-2-propan-2-ylbutanoate (PubChem CID 134214124) has the molecular formula C19H32O3 and a molecular weight of 308.46 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2,3-dimethyl-2-propan-2-ylbutanoate.
| Compound Name | (3-hydroxy-1-adamantyl) 2,3-dimethyl-2-propan-2-ylbutanoate |
|---|---|
| PubChem CID | 134214124 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2,3-dimethyl-2-propan-2-ylbutanoate |
| SMILES | CC(C)C(C)(C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(C)C |
| InChI | InChI=1S/C19H32O3/c1-12(2)17(5,13(3)4)16(20)22-19-9-14-6-15(10-19)8-18(21,7-14)11-19/h12-15,21H,6-11H2,1-5H3 |
| InChIKey | VDODQPKPOUXIJM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |