C72H138O3 — CID 123813247
(3-hydroxy-1-adamantyl) 2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecaethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,16-hexadecamethyloctadecanoate (PubChem CID 123813247) has the molecular formula C72H138O3 and a molecular weight of 1051.89 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecaethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,16-hexadecamethyloctadecanoate.
| Compound Name | (3-hydroxy-1-adamantyl) 2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecaethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,16-hexadecamethyloctadecanoate |
|---|---|
| PubChem CID | 123813247 |
| Molecular Formula | C72H138O3 |
| Molecular Weight | 1051.89 g/mol |
| Exact Mass | 1051.06 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2,3,4,5,6,7,8,9,10,11,12,13,14,15-tetradecaethyl-2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,16-hexadecamethyloctadecanoate |
| SMILES | CCC(C)(C)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(C)(CC)C(=O)OC12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C72H138O3/c1-32-56(16,17)58(19,34-3)60(21,36-5)62(23,38-7)64(25,40-9)66(27,42-11)68(29,44-13)70(31,46-15)69(30,45-14)67(28,43-12)65(26,41-10)63(24,39-8)61(22,37-6)59(20,35-4)57(18,33-2)55(73)75-72-50-53-47-54(51-72)49-71(74,48-53)52-72/h53-54,74H,32-52H2,1-31H3 |
| InChIKey | BAPVRTGGBDXMOZ-UHFFFAOYSA-N |
| XLogP | 22.88 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.89 |
| LogP ≤ 5 | 22.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |