C21H34O3 — CID 71187774
[(7R)-3-hydroxy-1-adamantyl] 2-tert-butyl-2,4-dimethylpent-3-enoate (PubChem CID 71187774) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is [(7R)-3-hydroxy-1-adamantyl] 2-tert-butyl-2,4-dimethylpent-3-enoate.
| Compound Name | [(7R)-3-hydroxy-1-adamantyl] 2-tert-butyl-2,4-dimethylpent-3-enoate |
|---|---|
| PubChem CID | 71187774 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | [(7R)-3-hydroxy-1-adamantyl] 2-tert-butyl-2,4-dimethylpent-3-enoate |
| SMILES | CC(C)=CC(C)(C(=O)OC12CC3C[C@H](CC(O)(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C21H34O3/c1-14(2)8-19(6,18(3,4)5)17(22)24-21-11-15-7-16(12-21)10-20(23,9-15)13-21/h8,15-16,23H,7,9-13H2,1-6H3/t15-,16?,19?,20?,21?/m1/s1 |
| InChIKey | DUZUHOGCWDWTPO-AQOULHAZSA-N |
| XLogP | 4.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|