C23H42O3 — CID 144531245
ethane;(3-hydroxy-1-adamantyl) 2-tert-butyl-4,4-dimethylpentanoate (PubChem CID 144531245) has the molecular formula C23H42O3 and a molecular weight of 366.59 g/mol. Its IUPAC name is ethane;(3-hydroxy-1-adamantyl) 2-tert-butyl-4,4-dimethylpentanoate.
| Compound Name | ethane;(3-hydroxy-1-adamantyl) 2-tert-butyl-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 144531245 |
| Molecular Formula | C23H42O3 |
| Molecular Weight | 366.59 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | ethane;(3-hydroxy-1-adamantyl) 2-tert-butyl-4,4-dimethylpentanoate |
| SMILES | CC.CC(C)(C)CC(C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(C)(C)C |
| InChI | InChI=1S/C21H36O3.C2H6/c1-18(2,3)12-16(19(4,5)6)17(22)24-21-10-14-7-15(11-21)9-20(23,8-14)13-21;1-2/h14-16,23H,7-13H2,1-6H3;1-2H3 |
| InChIKey | KYZUHCGOGHRPMI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.59 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |