C14H17F3O3 — CID 23593430
(3-hydroxy-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate (PubChem CID 23593430) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is (3-hydroxy-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | (3-hydroxy-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 23593430 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | (3-hydroxy-1-adamantyl) 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC12CC3CC(CC(O)(C3)C1)C2)C(F)(F)F |
| InChI | InChI=1S/C14H17F3O3/c1-8(14(15,16)17)11(18)20-13-5-9-2-10(6-13)4-12(19,3-9)7-13/h9-10,19H,1-7H2 |
| InChIKey | CUQIZOPBABDDBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|